C16H26O3 — CID 139588114
2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-5-methyloxane-3,4-diol (PubChem CID 139588114) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-5-methyloxane-3,4-diol.
| Compound Name | 2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-5-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 139588114 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-5-methyloxane-3,4-diol |
| SMILES | CCC/C=C/C=C/C=C(\C)C1OCC(C)C(O)C1O |
| InChI | InChI=1S/C16H26O3/c1-4-5-6-7-8-9-10-12(2)16-15(18)14(17)13(3)11-19-16/h6-10,13-18H,4-5,11H2,1-3H3/b7-6+,9-8+,12-10+ |
| InChIKey | SSDFRIQMXWLXBU-RWAOKGLLSA-N |
| XLogP | 2.60 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|