About 9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid
9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid (PubChem CID 139588123) has the molecular formula C21H33NO7
and a molecular weight of 411.50 g/mol. Its IUPAC name is 9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid.
Molecular Properties
| Compound Name | 9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid |
| PubChem CID | 139588123 |
| Molecular Formula | C21H33NO7 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid |
| SMILES | COC1COC(Oc2cccc(CCCCCCCCC(=O)O)c2N)C(O)C1O |
| InChI | InChI=1S/C21H33NO7/c1-27-16-13-28-21(20(26)19(16)25)29-15-11-8-10-14(18(15)22)9-6-4-2-3-5-7-12-17(23)24/h8,10-11,16,19-21,25-26H,2-7,9,12-13,22H2,1H3,(H,23,24) |
| InChIKey | KQOLQKAYOOFOJO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid?
The IUPAC name of 9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid (CID 139588123) is 9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid.
What is the SMILES notation for 9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid?
The canonical SMILES for 9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid is COC1COC(Oc2cccc(CCCCCCCCC(=O)O)c2N)C(O)C1O.
What is the InChIKey of 9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid?
The InChIKey is KQOLQKAYOOFOJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33NO7/c1-27-16-13-28-21(20(26)19(16)25)29-15-11-8-10-14(18(15)22)9-6-4-2-3-5-7-12-17(23)24/h8,10-11,16,19-21,25-26H,2-7,9,12-13,22H2,1H3,(H,23,24).
What are the key properties of 9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid?
9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid has a molecular weight of 411.50 g/mol, XLogP of 2.10, 12 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2-amino-3-(3,4-dihydroxy-5-methoxyoxan-2-yl)oxyphenyl]nonanoic acid is sourced from PubChem (CID 139588123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).