C27H37NO5 — CID 139588130
(10R,11S,12S,14R,26S)-10,11,12,14-tetrahydroxy-19,26-dimethyl-1-azacyclohexacosa-3,5,7,15,17,19,21,23-octaen-2-one (PubChem CID 139588130) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is (10R,11S,12S,14R,26S)-10,11,12,14-tetrahydroxy-19,26-dimethyl-1-azacyclohexacosa-3,5,7,15,17,19,21,23-octaen-2-one.
| Compound Name | (10R,11S,12S,14R,26S)-10,11,12,14-tetrahydroxy-19,26-dimethyl-1-azacyclohexacosa-3,5,7,15,17,19,21,23-octaen-2-one |
|---|---|
| PubChem CID | 139588130 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | (10R,11S,12S,14R,26S)-10,11,12,14-tetrahydroxy-19,26-dimethyl-1-azacyclohexacosa-3,5,7,15,17,19,21,23-octaen-2-one |
| SMILES | CC1=CC=CC=CC[C@H](C)NC(=O)C=CC=CC=CC[C@@H](O)[C@H](O)[C@@H](O)C[C@@H](O)C=CC=C1 |
| InChI | InChI=1S/C27H37NO5/c1-21-14-8-6-7-9-16-22(2)28-26(32)19-11-5-3-4-10-18-24(30)27(33)25(31)20-23(29)17-13-12-15-21/h3-15,17,19,22-25,27,29-31,33H,16,18,20H2,1-2H3,(H,28,32)/t22-,23-,24+,25-,27-/m0/s1 |
| InChIKey | MYLIUIYRQGCHBT-DKLFHUDLSA-N |
| XLogP | 2.96 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |