C12H18O3 — CID 139588204
(1S,2R,4S)-2-methyl-5-(3-methylbuta-1,3-dienyl)cyclohex-5-ene-1,2,4-triol (PubChem CID 139588204) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1S,2R,4S)-2-methyl-5-(3-methylbuta-1,3-dienyl)cyclohex-5-ene-1,2,4-triol.
| Compound Name | (1S,2R,4S)-2-methyl-5-(3-methylbuta-1,3-dienyl)cyclohex-5-ene-1,2,4-triol |
|---|---|
| PubChem CID | 139588204 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1S,2R,4S)-2-methyl-5-(3-methylbuta-1,3-dienyl)cyclohex-5-ene-1,2,4-triol |
| SMILES | C=C(C)C=CC1=C[C@H](O)[C@](C)(O)C[C@@H]1O |
| InChI | InChI=1S/C12H18O3/c1-8(2)4-5-9-6-11(14)12(3,15)7-10(9)13/h4-6,10-11,13-15H,1,7H2,2-3H3/t10-,11-,12+/m0/s1 |
| InChIKey | VHGODEKVNIYJQC-SDDRHHMPSA-N |
| XLogP | 0.92 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|