C28H34O7 — CID 139588445
[(1S,4R,10S,12R,13R,16R,21R,22R,23S)-3,6,7,17,22-pentamethyl-8,19-dioxo-5,11,24-trioxahexacyclo[19.2.1.04,10.04,13.013,23.016,22]tetracosa-2,6,17-trien-12-yl] acetate (PubChem CID 139588445) has the molecular formula C28H34O7 and a molecular weight of 482.57 g/mol. Its IUPAC name is [(1S,4R,10S,12R,13R,16R,21R,22R,23S)-3,6,7,17,22-pentamethyl-8,19-dioxo-5,11,24-trioxahexacyclo[19.2.1.04,10.04,13.013,23.016,22]tetracosa-2,6,17-trien-12-yl] acetate.
| Compound Name | [(1S,4R,10S,12R,13R,16R,21R,22R,23S)-3,6,7,17,22-pentamethyl-8,19-dioxo-5,11,24-trioxahexacyclo[19.2.1.04,10.04,13.013,23.016,22]tetracosa-2,6,17-trien-12-yl] acetate |
|---|---|
| PubChem CID | 139588445 |
| Molecular Formula | C28H34O7 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | [(1S,4R,10S,12R,13R,16R,21R,22R,23S)-3,6,7,17,22-pentamethyl-8,19-dioxo-5,11,24-trioxahexacyclo[19.2.1.04,10.04,13.013,23.016,22]tetracosa-2,6,17-trien-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@H]2CC(=O)C(C)=C(C)O[C@@]23C(C)=C[C@@H]2O[C@@H]4CC(=O)C=C(C)[C@H]5CC[C@]13[C@@H]2[C@@]54C |
| InChI | InChI=1S/C28H34O7/c1-13-9-18(30)11-22-26(6)19(13)7-8-27-24(26)21(33-22)10-14(2)28(27)23(34-25(27)32-17(5)29)12-20(31)15(3)16(4)35-28/h9-10,19,21-25H,7-8,11-12H2,1-6H3/t19-,21+,22-,23+,24+,25+,26+,27+,28+/m1/s1 |
| InChIKey | MPBWVNYITUYHFY-VKIAQROPSA-N |
| XLogP | 3.96 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|