C12H20O3 — CID 139588468
(2S,3S,5S)-2,3-bis(hydroxymethyl)-5-(3-methylbut-2-enyl)cyclopentan-1-one (PubChem CID 139588468) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (2S,3S,5S)-2,3-bis(hydroxymethyl)-5-(3-methylbut-2-enyl)cyclopentan-1-one.
| Compound Name | (2S,3S,5S)-2,3-bis(hydroxymethyl)-5-(3-methylbut-2-enyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 139588468 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (2S,3S,5S)-2,3-bis(hydroxymethyl)-5-(3-methylbut-2-enyl)cyclopentan-1-one |
| SMILES | CC(C)=CC[C@H]1C[C@H](CO)[C@@H](CO)C1=O |
| InChI | InChI=1S/C12H20O3/c1-8(2)3-4-9-5-10(6-13)11(7-14)12(9)15/h3,9-11,13-14H,4-7H2,1-2H3/t9-,10+,11+/m0/s1 |
| InChIKey | RIQBPOOLFXBSPM-HBNTYKKESA-N |
| XLogP | 1.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|