C15H20O2 — CID 139588469
(4S,4aS,5S)-4a,5-dimethyl-4-[(2R)-2-methyloxiran-2-yl]-4,5,6,7-tetrahydronaphthalen-1-one (PubChem CID 139588469) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (4S,4aS,5S)-4a,5-dimethyl-4-[(2R)-2-methyloxiran-2-yl]-4,5,6,7-tetrahydronaphthalen-1-one.
| Compound Name | (4S,4aS,5S)-4a,5-dimethyl-4-[(2R)-2-methyloxiran-2-yl]-4,5,6,7-tetrahydronaphthalen-1-one |
|---|---|
| PubChem CID | 139588469 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (4S,4aS,5S)-4a,5-dimethyl-4-[(2R)-2-methyloxiran-2-yl]-4,5,6,7-tetrahydronaphthalen-1-one |
| SMILES | C[C@H]1CCC=C2C(=O)C=C[C@H]([C@]3(C)CO3)[C@@]21C |
| InChI | InChI=1S/C15H20O2/c1-10-5-4-6-11-12(16)7-8-13(15(10,11)3)14(2)9-17-14/h6-8,10,13H,4-5,9H2,1-3H3/t10-,13+,14-,15+/m0/s1 |
| InChIKey | MFELRXPRKQWSKK-OADPDTJPSA-N |
| XLogP | 2.89 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|