C21H38O8 — CID 139588485
(3R,4S,5R,6S,7S,11R,12S,13R,14R)-14-ethyl-4,6,9,12-tetrahydroxy-9-(hydroxymethyl)-3,5,7,11,13-pentamethyl-oxacyclotetradecane-2,10-dione (PubChem CID 139588485) has the molecular formula C21H38O8 and a molecular weight of 418.53 g/mol. Its IUPAC name is (3R,4S,5R,6S,7S,11R,12S,13R,14R)-14-ethyl-4,6,9,12-tetrahydroxy-9-(hydroxymethyl)-3,5,7,11,13-pentamethyl-oxacyclotetradecane-2,10-dione.
| Compound Name | (3R,4S,5R,6S,7S,11R,12S,13R,14R)-14-ethyl-4,6,9,12-tetrahydroxy-9-(hydroxymethyl)-3,5,7,11,13-pentamethyl-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 139588485 |
| Molecular Formula | C21H38O8 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | (3R,4S,5R,6S,7S,11R,12S,13R,14R)-14-ethyl-4,6,9,12-tetrahydroxy-9-(hydroxymethyl)-3,5,7,11,13-pentamethyl-oxacyclotetradecane-2,10-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](O)[C@@H](C)CC(O)(CO)C(=O)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C21H38O8/c1-7-15-11(3)17(24)13(5)19(26)21(28,9-22)8-10(2)16(23)12(4)18(25)14(6)20(27)29-15/h10-18,22-25,28H,7-9H2,1-6H3/t10-,11-,12+,13+,14+,15+,16-,17-,18-,21?/m0/s1 |
| InChIKey | PREIDDIPLSAKJR-CFWJUOAESA-N |
| XLogP | 0.27 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |