C24H30O5 — CID 139588519
(6aR,9S,9aS)-6a-methyl-9-nonanoyl-3-[(E)-prop-1-enyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione (PubChem CID 139588519) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is (6aR,9S,9aS)-6a-methyl-9-nonanoyl-3-[(E)-prop-1-enyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione.
| Compound Name | (6aR,9S,9aS)-6a-methyl-9-nonanoyl-3-[(E)-prop-1-enyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione |
|---|---|
| PubChem CID | 139588519 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (6aR,9S,9aS)-6a-methyl-9-nonanoyl-3-[(E)-prop-1-enyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione |
| SMILES | C/C=C/C1=CC2=CC(=O)[C@]3(C)OC(=O)[C@H](C(=O)CCCCCCCC)[C@H]3C2=CO1 |
| InChI | InChI=1S/C24H30O5/c1-4-6-7-8-9-10-12-19(25)21-22-18-15-28-17(11-5-2)13-16(18)14-20(26)24(22,3)29-23(21)27/h5,11,13-15,21-22H,4,6-10,12H2,1-3H3/b11-5+/t21-,22-,24+/m1/s1 |
| InChIKey | MGXIYWIJISLRMT-AVVHGWNQSA-N |
| XLogP | 4.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|