C16H24O3 — CID 139588522
(4aS,6aR,8R,10aR,10bR)-8-(hydroxymethyl)-4a,10b-dimethyl-2,3,6a,7,8,9,10,10a-octahydrobenzo[f]chromen-1-one (PubChem CID 139588522) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (4aS,6aR,8R,10aR,10bR)-8-(hydroxymethyl)-4a,10b-dimethyl-2,3,6a,7,8,9,10,10a-octahydrobenzo[f]chromen-1-one.
| Compound Name | (4aS,6aR,8R,10aR,10bR)-8-(hydroxymethyl)-4a,10b-dimethyl-2,3,6a,7,8,9,10,10a-octahydrobenzo[f]chromen-1-one |
|---|---|
| PubChem CID | 139588522 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (4aS,6aR,8R,10aR,10bR)-8-(hydroxymethyl)-4a,10b-dimethyl-2,3,6a,7,8,9,10,10a-octahydrobenzo[f]chromen-1-one |
| SMILES | C[C@]12C=C[C@H]3C[C@H](CO)CC[C@H]3[C@@]1(C)C(=O)CCO2 |
| InChI | InChI=1S/C16H24O3/c1-15-7-5-12-9-11(10-17)3-4-13(12)16(15,2)14(18)6-8-19-15/h5,7,11-13,17H,3-4,6,8-10H2,1-2H3/t11-,12+,13-,15+,16+/m1/s1 |
| InChIKey | KWZDAZLEQWOPGV-WALBABNVSA-N |
| XLogP | 2.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|