About 3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one
3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one (PubChem CID 139588633) has the molecular formula C13H14O4
and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one.
Molecular Properties
| Compound Name | 3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one |
| PubChem CID | 139588633 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one |
| SMILES | C=C1COC(=O)C1(O)C(=O)C=CC=CC=CC |
| InChI | InChI=1S/C13H14O4/c1-3-4-5-6-7-8-11(14)13(16)10(2)9-17-12(13)15/h3-8,16H,2,9H2,1H3 |
| InChIKey | XJTTZELYOODEAA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one?
The IUPAC name of 3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one (CID 139588633) is 3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one.
What is the SMILES notation for 3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one?
The canonical SMILES for 3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one is C=C1COC(=O)C1(O)C(=O)C=CC=CC=CC.
What is the InChIKey of 3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one?
The InChIKey is XJTTZELYOODEAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O4/c1-3-4-5-6-7-8-11(14)13(16)10(2)9-17-12(13)15/h3-8,16H,2,9H2,1H3.
What are the key properties of 3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one?
3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one has a molecular weight of 234.25 g/mol, XLogP of 1.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4-methylidene-3-octa-2,4,6-trienoyloxolan-2-one is sourced from PubChem (CID 139588633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).