About 5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one
5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one (PubChem CID 139588650) has the molecular formula C11H16O5
and a molecular weight of 228.24 g/mol. Its IUPAC name is 5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one.
Molecular Properties
| Compound Name | 5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one |
| PubChem CID | 139588650 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one |
| SMILES | CC[C@H](O)[C@H](O)c1c(OC)cc(=O)oc1C |
| InChI | InChI=1S/C11H16O5/c1-4-7(12)11(14)10-6(2)16-9(13)5-8(10)15-3/h5,7,11-12,14H,4H2,1-3H3/t7-,11-/m0/s1 |
| InChIKey | GNJCYJKKXOQBEI-CPCISQLKSA-N |
| XLogP | 0.76 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one?
The IUPAC name of 5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one (CID 139588650) is 5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one.
What is the SMILES notation for 5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one?
The canonical SMILES for 5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one is CC[C@H](O)[C@H](O)c1c(OC)cc(=O)oc1C.
What is the InChIKey of 5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one?
The InChIKey is GNJCYJKKXOQBEI-CPCISQLKSA-N. The full InChI is InChI=1S/C11H16O5/c1-4-7(12)11(14)10-6(2)16-9(13)5-8(10)15-3/h5,7,11-12,14H,4H2,1-3H3/t7-,11-/m0/s1.
What are the key properties of 5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one?
5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one has a molecular weight of 228.24 g/mol, XLogP of 0.76, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R,2S)-1,2-dihydroxybutyl]-4-methoxy-6-methylpyran-2-one is sourced from PubChem (CID 139588650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).