C28H48O4 — CID 139588663
(4E,6S,7S,8E,10S,11S,12E,14S,15S,16E,18S)-7,11,15-trihydroxy-4,6,8,10,12,14,16,18-octamethylicosa-4,8,12,16-tetraen-3-one (PubChem CID 139588663) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is (4E,6S,7S,8E,10S,11S,12E,14S,15S,16E,18S)-7,11,15-trihydroxy-4,6,8,10,12,14,16,18-octamethylicosa-4,8,12,16-tetraen-3-one.
| Compound Name | (4E,6S,7S,8E,10S,11S,12E,14S,15S,16E,18S)-7,11,15-trihydroxy-4,6,8,10,12,14,16,18-octamethylicosa-4,8,12,16-tetraen-3-one |
|---|---|
| PubChem CID | 139588663 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | (4E,6S,7S,8E,10S,11S,12E,14S,15S,16E,18S)-7,11,15-trihydroxy-4,6,8,10,12,14,16,18-octamethylicosa-4,8,12,16-tetraen-3-one |
| SMILES | CCC(=O)/C(C)=C/[C@H](C)[C@H](O)/C(C)=C/[C@H](C)[C@H](O)/C(C)=C/[C@H](C)[C@H](O)/C(C)=C/[C@@H](C)CC |
| InChI | InChI=1S/C28H48O4/c1-11-17(3)13-19(5)26(30)21(7)15-23(9)28(32)24(10)16-22(8)27(31)20(6)14-18(4)25(29)12-2/h13-17,20-21,24,26-28,30-32H,11-12H2,1-10H3/b18-14+,19-13+,22-16+,23-15+/t17-,20-,21-,24-,26+,27-,28+/m0/s1 |
| InChIKey | MFSKGDFHTCLHJG-OXOPWONBSA-N |
| XLogP | 5.79 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|