C28H46O5 — CID 139588664
(6E,8S,9S,10E,12S,13S,14E,16S,17S,18E)-9,13,17-trihydroxy-4,6,8,10,12,14,16,18-octamethylicosa-6,10,14,18-tetraene-3,5-dione (PubChem CID 139588664) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is (6E,8S,9S,10E,12S,13S,14E,16S,17S,18E)-9,13,17-trihydroxy-4,6,8,10,12,14,16,18-octamethylicosa-6,10,14,18-tetraene-3,5-dione.
| Compound Name | (6E,8S,9S,10E,12S,13S,14E,16S,17S,18E)-9,13,17-trihydroxy-4,6,8,10,12,14,16,18-octamethylicosa-6,10,14,18-tetraene-3,5-dione |
|---|---|
| PubChem CID | 139588664 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | (6E,8S,9S,10E,12S,13S,14E,16S,17S,18E)-9,13,17-trihydroxy-4,6,8,10,12,14,16,18-octamethylicosa-6,10,14,18-tetraene-3,5-dione |
| SMILES | C/C=C(\C)[C@@H](O)[C@@H](C)/C=C(\C)[C@@H](O)[C@@H](C)/C=C(\C)[C@@H](O)[C@@H](C)/C=C(\C)C(=O)C(C)C(=O)CC |
| InChI | InChI=1S/C28H46O5/c1-11-16(3)25(30)17(4)13-18(5)26(31)19(6)14-20(7)27(32)21(8)15-22(9)28(33)23(10)24(29)12-2/h11,13-15,17,19,21,23,25-27,30-32H,12H2,1-10H3/b16-11+,18-13+,20-14+,22-15+/t17-,19-,21-,23?,25+,26+,27+/m0/s1 |
| InChIKey | QWFMDHKSLNZZQY-QAMBGQJBSA-N |
| XLogP | 4.97 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|