C28H35NO4 — CID 139588745
(2R,3E,5R,7S,9E,11S,14R,15R,16R)-16-benzyl-2,5-dihydroxy-5,7,13,14-tetramethyl-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-triene-6,18-dione (PubChem CID 139588745) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is (2R,3E,5R,7S,9E,11S,14R,15R,16R)-16-benzyl-2,5-dihydroxy-5,7,13,14-tetramethyl-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-triene-6,18-dione.
| Compound Name | (2R,3E,5R,7S,9E,11S,14R,15R,16R)-16-benzyl-2,5-dihydroxy-5,7,13,14-tetramethyl-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-triene-6,18-dione |
|---|---|
| PubChem CID | 139588745 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | (2R,3E,5R,7S,9E,11S,14R,15R,16R)-16-benzyl-2,5-dihydroxy-5,7,13,14-tetramethyl-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-triene-6,18-dione |
| SMILES | CC1=CC2/C=C/C[C@H](C)C(=O)[C@](C)(O)/C=C/[C@@H](O)C23C(=O)N[C@H](Cc2ccccc2)[C@@H]3[C@H]1C |
| InChI | InChI=1S/C28H35NO4/c1-17-9-8-12-21-15-18(2)19(3)24-22(16-20-10-6-5-7-11-20)29-26(32)28(21,24)23(30)13-14-27(4,33)25(17)31/h5-8,10-15,17,19,21-24,30,33H,9,16H2,1-4H3,(H,29,32)/b12-8+,14-13+/t17-,19-,21?,22+,23+,24-,27+,28?/m0/s1 |
| InChIKey | TUOTYDFTSBXZFM-ZKGBQAQYSA-N |
| XLogP | 3.38 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|