C28H40O5 — CID 139588797
(E)-3-[(1E,3S,5E,9E,11Z,14R,15Z)-14-methoxy-3,15,18-trimethylnonadeca-1,5,9,11,15,17-hexaenyl]pent-2-enedioic acid (PubChem CID 139588797) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is (E)-3-[(1E,3S,5E,9E,11Z,14R,15Z)-14-methoxy-3,15,18-trimethylnonadeca-1,5,9,11,15,17-hexaenyl]pent-2-enedioic acid.
| Compound Name | (E)-3-[(1E,3S,5E,9E,11Z,14R,15Z)-14-methoxy-3,15,18-trimethylnonadeca-1,5,9,11,15,17-hexaenyl]pent-2-enedioic acid |
|---|---|
| PubChem CID | 139588797 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | (E)-3-[(1E,3S,5E,9E,11Z,14R,15Z)-14-methoxy-3,15,18-trimethylnonadeca-1,5,9,11,15,17-hexaenyl]pent-2-enedioic acid |
| SMILES | CO[C@H](C/C=C\C=C\CC/C=C/C[C@H](C)/C=C/C(=C/C(=O)O)CC(=O)O)/C(C)=C\C=C(C)C |
| InChI | InChI=1S/C28H40O5/c1-22(2)16-18-24(4)26(33-5)15-13-11-9-7-6-8-10-12-14-23(3)17-19-25(20-27(29)30)21-28(31)32/h7,9-13,16-20,23,26H,6,8,14-15,21H2,1-5H3,(H,29,30)(H,31,32)/b9-7+,12-10+,13-11-,19-17+,24-18-,25-20-/t23-,26+/m0/s1 |
| InChIKey | GYDAWNYQSVBMMP-ZJDVEIHBSA-N |
| XLogP | 6.82 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|