C18H24O4 — CID 139588829
(4bS)-7-ethenyl-2,4b,10-trihydroxy-1,1-dimethyl-3,4,4a,5,6,7-hexahydro-2H-phenanthren-9-one (PubChem CID 139588829) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (4bS)-7-ethenyl-2,4b,10-trihydroxy-1,1-dimethyl-3,4,4a,5,6,7-hexahydro-2H-phenanthren-9-one.
| Compound Name | (4bS)-7-ethenyl-2,4b,10-trihydroxy-1,1-dimethyl-3,4,4a,5,6,7-hexahydro-2H-phenanthren-9-one |
|---|---|
| PubChem CID | 139588829 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (4bS)-7-ethenyl-2,4b,10-trihydroxy-1,1-dimethyl-3,4,4a,5,6,7-hexahydro-2H-phenanthren-9-one |
| SMILES | C=CC1C=C2C(=O)C(O)=C3C(CCC(O)C3(C)C)[C@@]2(O)CC1 |
| InChI | InChI=1S/C18H24O4/c1-4-10-7-8-18(22)11-5-6-13(19)17(2,3)14(11)16(21)15(20)12(18)9-10/h4,9-11,13,19,21-22H,1,5-8H2,2-3H3/t10?,11?,13?,18-/m0/s1 |
| InChIKey | RBCSLMHDDJQRHE-GNTHLIOLSA-N |
| XLogP | 2.43 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|