C22H32N2O9S — CID 139589192
2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1S,2S)-2-hydroxy-1-[[(2R)-pyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2-hydroxybenzoate (PubChem CID 139589192) has the molecular formula C22H32N2O9S and a molecular weight of 500.57 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1S,2S)-2-hydroxy-1-[[(2R)-pyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2-hydroxybenzoate.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1S,2S)-2-hydroxy-1-[[(2R)-pyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2-hydroxybenzoate |
|---|---|
| PubChem CID | 139589192 |
| Molecular Formula | C22H32N2O9S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1S,2S)-2-hydroxy-1-[[(2R)-pyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 2-hydroxybenzoate |
| SMILES | C[C@H](O)[C@H](NC(=O)[C@H]1CCCN1)[C@H]1O[C@H](SCCOC(=O)c2ccccc2O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H32N2O9S/c1-11(25)15(24-20(30)13-6-4-8-23-13)19-17(28)16(27)18(29)22(33-19)34-10-9-32-21(31)12-5-2-3-7-14(12)26/h2-3,5,7,11,13,15-19,22-23,25-29H,4,6,8-10H2,1H3,(H,24,30)/t11-,13+,15-,16-,17+,18+,19+,22+/m0/s1 |
| InChIKey | GEJPGRHNEXXHBZ-PWOXNDPSSA-N |
| XLogP | -1.29 |
| TPSA | 177.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|