C24H38N4O7 — CID 139589450
[5-[3-[(2S,5S)-5-[3-[(5-hydroxy-3-methylpent-2-enoyl)amino]propyl]-3,6-dioxopiperazin-2-yl]propylamino]-3-methyl-5-oxopent-3-enyl] acetate (PubChem CID 139589450) has the molecular formula C24H38N4O7 and a molecular weight of 494.59 g/mol. Its IUPAC name is [5-[3-[(2S,5S)-5-[3-[(5-hydroxy-3-methylpent-2-enoyl)amino]propyl]-3,6-dioxopiperazin-2-yl]propylamino]-3-methyl-5-oxopent-3-enyl] acetate.
| Compound Name | [5-[3-[(2S,5S)-5-[3-[(5-hydroxy-3-methylpent-2-enoyl)amino]propyl]-3,6-dioxopiperazin-2-yl]propylamino]-3-methyl-5-oxopent-3-enyl] acetate |
|---|---|
| PubChem CID | 139589450 |
| Molecular Formula | C24H38N4O7 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | [5-[3-[(2S,5S)-5-[3-[(5-hydroxy-3-methylpent-2-enoyl)amino]propyl]-3,6-dioxopiperazin-2-yl]propylamino]-3-methyl-5-oxopent-3-enyl] acetate |
| SMILES | CC(=O)OCCC(C)=CC(=O)NCCC[C@@H]1NC(=O)[C@H](CCCNC(=O)C=C(C)CCO)NC1=O |
| InChI | InChI=1S/C24H38N4O7/c1-16(8-12-29)14-21(31)25-10-4-6-19-23(33)28-20(24(34)27-19)7-5-11-26-22(32)15-17(2)9-13-35-18(3)30/h14-15,19-20,29H,4-13H2,1-3H3,(H,25,31)(H,26,32)(H,27,34)(H,28,33)/t19-,20-/m0/s1 |
| InChIKey | RZPDQEPMHAHTJR-PMACEKPBSA-N |
| XLogP | -0.01 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|