C15H18O3 — CID 139589461
(4aR,8aR)-3-(hydroxymethyl)-5,8a-dimethyl-4,4a,7,8-tetrahydrobenzo[f][1]benzofuran-2-one (PubChem CID 139589461) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (4aR,8aR)-3-(hydroxymethyl)-5,8a-dimethyl-4,4a,7,8-tetrahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (4aR,8aR)-3-(hydroxymethyl)-5,8a-dimethyl-4,4a,7,8-tetrahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 139589461 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (4aR,8aR)-3-(hydroxymethyl)-5,8a-dimethyl-4,4a,7,8-tetrahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1=CCC[C@@]2(C)C=C3OC(=O)C(CO)=C3C[C@H]12 |
| InChI | InChI=1S/C15H18O3/c1-9-4-3-5-15(2)7-13-10(6-12(9)15)11(8-16)14(17)18-13/h4,7,12,16H,3,5-6,8H2,1-2H3/t12-,15+/m1/s1 |
| InChIKey | YGAZFGCBVZLCRF-DOMZBBRYSA-N |
| XLogP | 2.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|