C22H36O6 — CID 139589469
methyl (2E,4E,6S)-6-[(2S,3S,4R,5S,6S,8R,9S,10R)-9-ethyl-4,10-dihydroxy-3,5,8-trimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]hepta-2,4-dienoate (PubChem CID 139589469) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is methyl (2E,4E,6S)-6-[(2S,3S,4R,5S,6S,8R,9S,10R)-9-ethyl-4,10-dihydroxy-3,5,8-trimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]hepta-2,4-dienoate.
| Compound Name | methyl (2E,4E,6S)-6-[(2S,3S,4R,5S,6S,8R,9S,10R)-9-ethyl-4,10-dihydroxy-3,5,8-trimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]hepta-2,4-dienoate |
|---|---|
| PubChem CID | 139589469 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | methyl (2E,4E,6S)-6-[(2S,3S,4R,5S,6S,8R,9S,10R)-9-ethyl-4,10-dihydroxy-3,5,8-trimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]hepta-2,4-dienoate |
| SMILES | CC[C@H]1[C@H](O)C[C@@]2(O[C@@H]([C@@H](C)/C=C/C=C/C(=O)OC)[C@@H](C)[C@@H](O)[C@@H]2C)O[C@@H]1C |
| InChI | InChI=1S/C22H36O6/c1-7-17-16(5)27-22(12-18(17)23)15(4)20(25)14(3)21(28-22)13(2)10-8-9-11-19(24)26-6/h8-11,13-18,20-21,23,25H,7,12H2,1-6H3/b10-8+,11-9+/t13-,14-,15-,16+,17+,18+,20+,21-,22-/m0/s1 |
| InChIKey | MSFATTXTDHLTMG-DMTWHGMHSA-N |
| XLogP | 2.83 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|