C27H40O7 — CID 139589490
(1S,4R,7S,8aR)-7-(3,3-dimethoxyprop-1-en-2-yl)-4-[(Z)-2,4-dimethyloct-2-enoyl]oxy-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalene-1-carboxylic acid (PubChem CID 139589490) has the molecular formula C27H40O7 and a molecular weight of 476.61 g/mol. Its IUPAC name is (1S,4R,7S,8aR)-7-(3,3-dimethoxyprop-1-en-2-yl)-4-[(Z)-2,4-dimethyloct-2-enoyl]oxy-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalene-1-carboxylic acid.
| Compound Name | (1S,4R,7S,8aR)-7-(3,3-dimethoxyprop-1-en-2-yl)-4-[(Z)-2,4-dimethyloct-2-enoyl]oxy-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 139589490 |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | (1S,4R,7S,8aR)-7-(3,3-dimethoxyprop-1-en-2-yl)-4-[(Z)-2,4-dimethyloct-2-enoyl]oxy-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalene-1-carboxylic acid |
| SMILES | C=C(C(OC)OC)[C@@H]1C[C@@]2(C)C(=CC1=O)[C@H](OC(=O)/C(C)=C\C(C)CCCC)CC[C@@H]2C(=O)O |
| InChI | InChI=1S/C27H40O7/c1-8-9-10-16(2)13-17(3)25(31)34-23-12-11-20(24(29)30)27(5)15-19(22(28)14-21(23)27)18(4)26(32-6)33-7/h13-14,16,19-20,23,26H,4,8-12,15H2,1-3,5-7H3,(H,29,30)/b17-13-/t16?,19-,20+,23+,27+/m0/s1 |
| InChIKey | VEUYHTJQTVNYEG-INVGCCSMSA-N |
| XLogP | 4.86 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|