C14H22O7 — CID 139589502
(4S,7R)-7-[(4R,5S)-4,5-dihydroxyhex-2-enoyl]oxy-4-hydroxyoct-2-enoic acid (PubChem CID 139589502) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is (4S,7R)-7-[(4R,5S)-4,5-dihydroxyhex-2-enoyl]oxy-4-hydroxyoct-2-enoic acid.
| Compound Name | (4S,7R)-7-[(4R,5S)-4,5-dihydroxyhex-2-enoyl]oxy-4-hydroxyoct-2-enoic acid |
|---|---|
| PubChem CID | 139589502 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (4S,7R)-7-[(4R,5S)-4,5-dihydroxyhex-2-enoyl]oxy-4-hydroxyoct-2-enoic acid |
| SMILES | C[C@H](CC[C@H](O)C=CC(=O)O)OC(=O)C=C[C@@H](O)[C@H](C)O |
| InChI | InChI=1S/C14H22O7/c1-9(3-4-11(16)5-7-13(18)19)21-14(20)8-6-12(17)10(2)15/h5-12,15-17H,3-4H2,1-2H3,(H,18,19)/t9-,10+,11+,12-/m1/s1 |
| InChIKey | IBCGSBLAZKITEU-NOOOWODRSA-N |
| XLogP | -0.00 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|