C25H23NO7 — CID 139589525
5-[(2R,4R,5S,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]-1,6,8-trihydroxy-3-methylbenzo[a]anthracene-7,12-dione (PubChem CID 139589525) has the molecular formula C25H23NO7 and a molecular weight of 449.46 g/mol. Its IUPAC name is 5-[(2R,4R,5S,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]-1,6,8-trihydroxy-3-methylbenzo[a]anthracene-7,12-dione.
| Compound Name | 5-[(2R,4R,5S,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]-1,6,8-trihydroxy-3-methylbenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 139589525 |
| Molecular Formula | C25H23NO7 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 5-[(2R,4R,5S,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]-1,6,8-trihydroxy-3-methylbenzo[a]anthracene-7,12-dione |
| SMILES | Cc1cc(O)c2c3c(c(O)c([C@H]4C[C@@H](N)[C@H](O)[C@@H](C)O4)c2c1)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C25H23NO7/c1-9-6-12-17(15(28)7-9)20-21(24(31)18-11(23(20)30)4-3-5-14(18)27)25(32)19(12)16-8-13(26)22(29)10(2)33-16/h3-7,10,13,16,22,27-29,32H,8,26H2,1-2H3/t10-,13-,16-,22-/m1/s1 |
| InChIKey | YNBJLMMIDVNPQX-WZSPRZBJSA-N |
| XLogP | 2.58 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'keto_naphthol_A(2)', 'substructure': 'N/A'} |
|---|