C21H26O5 — CID 139589592
(2E)-2-[(7S,8R,8aR)-7-[(E)-hex-4-enoyl]oxy-8,8a-dimethyl-3-oxo-7,8-dihydro-1H-naphthalen-2-ylidene]propanoic acid (PubChem CID 139589592) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (2E)-2-[(7S,8R,8aR)-7-[(E)-hex-4-enoyl]oxy-8,8a-dimethyl-3-oxo-7,8-dihydro-1H-naphthalen-2-ylidene]propanoic acid.
| Compound Name | (2E)-2-[(7S,8R,8aR)-7-[(E)-hex-4-enoyl]oxy-8,8a-dimethyl-3-oxo-7,8-dihydro-1H-naphthalen-2-ylidene]propanoic acid |
|---|---|
| PubChem CID | 139589592 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (2E)-2-[(7S,8R,8aR)-7-[(E)-hex-4-enoyl]oxy-8,8a-dimethyl-3-oxo-7,8-dihydro-1H-naphthalen-2-ylidene]propanoic acid |
| SMILES | C/C=C/CCC(=O)O[C@H]1C=CC2=CC(=O)/C(=C(\C)C(=O)O)C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C21H26O5/c1-5-6-7-8-19(23)26-18-10-9-15-11-17(22)16(13(2)20(24)25)12-21(15,4)14(18)3/h5-6,9-11,14,18H,7-8,12H2,1-4H3,(H,24,25)/b6-5+,16-13+/t14-,18-,21+/m0/s1 |
| InChIKey | RYRWDTCJZOGBTD-CQQVTTSESA-N |
| XLogP | 3.77 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|