C15H22O4 — CID 139589630
(8S,9Z,14S)-8-methoxy-14-methyl-1-oxacyclotetradeca-6,9-diene-2,5-dione (PubChem CID 139589630) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (8S,9Z,14S)-8-methoxy-14-methyl-1-oxacyclotetradeca-6,9-diene-2,5-dione.
| Compound Name | (8S,9Z,14S)-8-methoxy-14-methyl-1-oxacyclotetradeca-6,9-diene-2,5-dione |
|---|---|
| PubChem CID | 139589630 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (8S,9Z,14S)-8-methoxy-14-methyl-1-oxacyclotetradeca-6,9-diene-2,5-dione |
| SMILES | CO[C@@H]1C=CC(=O)CCC(=O)O[C@@H](C)CCC/C=C\1 |
| InChI | InChI=1S/C15H22O4/c1-12-6-4-3-5-7-14(18-2)10-8-13(16)9-11-15(17)19-12/h5,7-8,10,12,14H,3-4,6,9,11H2,1-2H3/b7-5-,10-8?/t12-,14-/m0/s1 |
| InChIKey | ILUIRKCKSQCXHD-RQMUNBLCSA-N |
| XLogP | 2.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|