C47H32O7 — CID 139589633
4-(4,5-dihydroxy-2-methoxy-3,6-diphenylphenyl)-7,10-diphenylnaphtho[1,2-b][1]benzofuran-1,8,9-triol (PubChem CID 139589633) has the molecular formula C47H32O7 and a molecular weight of 708.77 g/mol. Its IUPAC name is 4-(4,5-dihydroxy-2-methoxy-3,6-diphenylphenyl)-7,10-diphenylnaphtho[1,2-b][1]benzofuran-1,8,9-triol.
| Compound Name | 4-(4,5-dihydroxy-2-methoxy-3,6-diphenylphenyl)-7,10-diphenylnaphtho[1,2-b][1]benzofuran-1,8,9-triol |
|---|---|
| PubChem CID | 139589633 |
| Molecular Formula | C47H32O7 |
| Molecular Weight | 708.77 g/mol |
| Exact Mass | 708.21 |
| IUPAC Name | 4-(4,5-dihydroxy-2-methoxy-3,6-diphenylphenyl)-7,10-diphenylnaphtho[1,2-b][1]benzofuran-1,8,9-triol |
| SMILES | COc1c(-c2ccccc2)c(O)c(O)c(-c2ccccc2)c1-c1ccc(O)c2c1ccc1c2oc2c(-c3ccccc3)c(O)c(O)c(-c3ccccc3)c21 |
| InChI | InChI=1S/C47H32O7/c1-53-46-36(28-18-10-4-11-19-28)43(51)41(49)34(26-14-6-2-7-15-26)39(46)31-24-25-33(48)38-30(31)22-23-32-40-35(27-16-8-3-9-17-27)42(50)44(52)37(47(40)54-45(32)38)29-20-12-5-13-21-29/h2-25,48-52H,1H3 |
| InChIKey | UNLYIMWGYPZNIV-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.77 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|