C14H22O3 — CID 139589702
(2S,3R,4S)-2-[(1E,3E,5E)-nona-1,3,5-trienyl]oxane-3,4-diol (PubChem CID 139589702) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2S,3R,4S)-2-[(1E,3E,5E)-nona-1,3,5-trienyl]oxane-3,4-diol.
| Compound Name | (2S,3R,4S)-2-[(1E,3E,5E)-nona-1,3,5-trienyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 139589702 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (2S,3R,4S)-2-[(1E,3E,5E)-nona-1,3,5-trienyl]oxane-3,4-diol |
| SMILES | CCC/C=C/C=C/C=C/[C@@H]1OCC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H22O3/c1-2-3-4-5-6-7-8-9-13-14(16)12(15)10-11-17-13/h4-9,12-16H,2-3,10-11H2,1H3/b5-4+,7-6+,9-8+/t12-,13-,14+/m0/s1 |
| InChIKey | AVLDYOYSUDIRTQ-QPZRZZSYSA-N |
| XLogP | 1.97 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|