C15H24O3 — CID 139589728
(3S,3aR,3bS,6aS,7aR)-6a,7a-dihydroxy-3,3a,5,5-tetramethyl-1,3,3b,4,6,7-hexahydrocyclopenta[a]pentalen-2-one (PubChem CID 139589728) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (3S,3aR,3bS,6aS,7aR)-6a,7a-dihydroxy-3,3a,5,5-tetramethyl-1,3,3b,4,6,7-hexahydrocyclopenta[a]pentalen-2-one.
| Compound Name | (3S,3aR,3bS,6aS,7aR)-6a,7a-dihydroxy-3,3a,5,5-tetramethyl-1,3,3b,4,6,7-hexahydrocyclopenta[a]pentalen-2-one |
|---|---|
| PubChem CID | 139589728 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3S,3aR,3bS,6aS,7aR)-6a,7a-dihydroxy-3,3a,5,5-tetramethyl-1,3,3b,4,6,7-hexahydrocyclopenta[a]pentalen-2-one |
| SMILES | C[C@@H]1C(=O)C[C@]2(O)C[C@@]3(O)CC(C)(C)C[C@H]3[C@]12C |
| InChI | InChI=1S/C15H24O3/c1-9-10(16)5-15(18)8-14(17)7-12(2,3)6-11(14)13(9,15)4/h9,11,17-18H,5-8H2,1-4H3/t9-,11+,13+,14+,15+/m1/s1 |
| InChIKey | LZQPXRLCHCOCTF-PPTOVHHBSA-N |
| XLogP | 1.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |