C16H22O3 — CID 139589749
(4aR,6aR,8R,10aS,10bR)-4a,8,10b-trimethyl-3,6a,7,8,9,10a-hexahydro-2H-benzo[f]chromene-1,10-dione (PubChem CID 139589749) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4aR,6aR,8R,10aS,10bR)-4a,8,10b-trimethyl-3,6a,7,8,9,10a-hexahydro-2H-benzo[f]chromene-1,10-dione.
| Compound Name | (4aR,6aR,8R,10aS,10bR)-4a,8,10b-trimethyl-3,6a,7,8,9,10a-hexahydro-2H-benzo[f]chromene-1,10-dione |
|---|---|
| PubChem CID | 139589749 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (4aR,6aR,8R,10aS,10bR)-4a,8,10b-trimethyl-3,6a,7,8,9,10a-hexahydro-2H-benzo[f]chromene-1,10-dione |
| SMILES | C[C@H]1CC(=O)[C@H]2[C@@H](C=C[C@@]3(C)OCCC(=O)[C@]23C)C1 |
| InChI | InChI=1S/C16H22O3/c1-10-8-11-4-6-15(2)16(3,13(18)5-7-19-15)14(11)12(17)9-10/h4,6,10-11,14H,5,7-9H2,1-3H3/t10-,11+,14-,15-,16-/m1/s1 |
| InChIKey | ITWYWAQNTCPFOM-LZYVBGRKSA-N |
| XLogP | 2.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|