C20H30O3 — CID 139589750
(1R,2'R,3'R,3bR,4S,5'R,6aR)-3'-hydroxy-2',4,5',6a-tetramethylspiro[2,3,3b,5,6,7-hexahydrocyclopenta[a]pentalene-1,1'-cyclopentane]-4-carboxylic acid (PubChem CID 139589750) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,2'R,3'R,3bR,4S,5'R,6aR)-3'-hydroxy-2',4,5',6a-tetramethylspiro[2,3,3b,5,6,7-hexahydrocyclopenta[a]pentalene-1,1'-cyclopentane]-4-carboxylic acid.
| Compound Name | (1R,2'R,3'R,3bR,4S,5'R,6aR)-3'-hydroxy-2',4,5',6a-tetramethylspiro[2,3,3b,5,6,7-hexahydrocyclopenta[a]pentalene-1,1'-cyclopentane]-4-carboxylic acid |
|---|---|
| PubChem CID | 139589750 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,2'R,3'R,3bR,4S,5'R,6aR)-3'-hydroxy-2',4,5',6a-tetramethylspiro[2,3,3b,5,6,7-hexahydrocyclopenta[a]pentalene-1,1'-cyclopentane]-4-carboxylic acid |
| SMILES | C[C@@H]1C[C@@H](O)[C@H](C)[C@@]12CCC1=C2C[C@@]2(C)CC[C@](C)(C(=O)O)[C@@H]12 |
| InChI | InChI=1S/C20H30O3/c1-11-9-15(21)12(2)20(11)6-5-13-14(20)10-18(3)7-8-19(4,16(13)18)17(22)23/h11-12,15-16,21H,5-10H2,1-4H3,(H,22,23)/t11-,12+,15-,16+,18-,19+,20-/m1/s1 |
| InChIKey | IXEKUSSTAAFIKN-FKBRWOSRSA-N |
| XLogP | 4.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|