C25H28O4 — CID 139589770
(1R,2S,3S,8R,11S,13S,19S)-3,7,7,13-tetramethyl-20-methylidene-17-oxahexacyclo[11.7.1.02,11.03,8.011,19.015,19]henicosa-4,14-diene-6,16,21-trione (PubChem CID 139589770) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is (1R,2S,3S,8R,11S,13S,19S)-3,7,7,13-tetramethyl-20-methylidene-17-oxahexacyclo[11.7.1.02,11.03,8.011,19.015,19]henicosa-4,14-diene-6,16,21-trione.
| Compound Name | (1R,2S,3S,8R,11S,13S,19S)-3,7,7,13-tetramethyl-20-methylidene-17-oxahexacyclo[11.7.1.02,11.03,8.011,19.015,19]henicosa-4,14-diene-6,16,21-trione |
|---|---|
| PubChem CID | 139589770 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (1R,2S,3S,8R,11S,13S,19S)-3,7,7,13-tetramethyl-20-methylidene-17-oxahexacyclo[11.7.1.02,11.03,8.011,19.015,19]henicosa-4,14-diene-6,16,21-trione |
| SMILES | C=C1[C@@H]2C(=O)[C@]3(C)C=C4C(=O)OC[C@]14[C@@]1(CC[C@H]4C(C)(C)C(=O)C=C[C@]4(C)[C@H]21)C3 |
| InChI | InChI=1S/C25H28O4/c1-13-17-18-23(5)8-7-16(26)21(2,3)15(23)6-9-24(18)11-22(4,19(17)27)10-14-20(28)29-12-25(13,14)24/h7-8,10,15,17-18H,1,6,9,11-12H2,2-5H3/t15-,17-,18-,22+,23-,24-,25-/m0/s1 |
| InChIKey | ARYKIJCLHMOALX-GIZQAJFUSA-N |
| XLogP | 3.82 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|