C24H34O5 — CID 139589775
2-[(2E,6E,9S)-9-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 139589775) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is 2-[(2E,6E,9S)-9-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(2E,6E,9S)-9-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 139589775 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 2-[(2E,6E,9S)-9-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(C/C=C(\C)CC/C=C(\C)C[C@H](O)C=C(C)C)=C(C)C1=O |
| InChI | InChI=1S/C24H34O5/c1-15(2)13-19(25)14-17(4)10-8-9-16(3)11-12-20-18(5)21(26)23(28-6)24(29-7)22(20)27/h10-11,13,19,25H,8-9,12,14H2,1-7H3/b16-11+,17-10+/t19-/m1/s1 |
| InChIKey | FGNQCSVHEUANOF-UGPPNHOWSA-N |
| XLogP | 4.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|