C21H32O6 — CID 139589791
(2R,3aR,5S,9aR)-2-[(E)-5,6-dihydroxy-2,6-dimethylhept-1-enyl]-5-hydroxy-3a-methyl-3,5,6,7,9,9a-hexahydro-2H-furo[3,2-b]chromen-8-one (PubChem CID 139589791) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is (2R,3aR,5S,9aR)-2-[(E)-5,6-dihydroxy-2,6-dimethylhept-1-enyl]-5-hydroxy-3a-methyl-3,5,6,7,9,9a-hexahydro-2H-furo[3,2-b]chromen-8-one.
| Compound Name | (2R,3aR,5S,9aR)-2-[(E)-5,6-dihydroxy-2,6-dimethylhept-1-enyl]-5-hydroxy-3a-methyl-3,5,6,7,9,9a-hexahydro-2H-furo[3,2-b]chromen-8-one |
|---|---|
| PubChem CID | 139589791 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (2R,3aR,5S,9aR)-2-[(E)-5,6-dihydroxy-2,6-dimethylhept-1-enyl]-5-hydroxy-3a-methyl-3,5,6,7,9,9a-hexahydro-2H-furo[3,2-b]chromen-8-one |
| SMILES | C/C(=C\[C@H]1C[C@@]2(C)OC3=C(C[C@H]2O1)C(=O)CC[C@@H]3O)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C21H32O6/c1-12(5-8-17(24)20(2,3)25)9-13-11-21(4)18(26-13)10-14-15(22)6-7-16(23)19(14)27-21/h9,13,16-18,23-25H,5-8,10-11H2,1-4H3/b12-9+/t13-,16-,17?,18+,21+/m0/s1 |
| InChIKey | FWXCOKASJBNAHR-MKZAAYLKSA-N |
| XLogP | 2.16 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|