C21H30O4 — CID 139589793
(2R,3aR,5S,9aR)-2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-5-hydroxy-3a-methyl-3,5,6,7,9,9a-hexahydro-2H-furo[3,2-b]chromen-8-one (PubChem CID 139589793) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (2R,3aR,5S,9aR)-2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-5-hydroxy-3a-methyl-3,5,6,7,9,9a-hexahydro-2H-furo[3,2-b]chromen-8-one.
| Compound Name | (2R,3aR,5S,9aR)-2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-5-hydroxy-3a-methyl-3,5,6,7,9,9a-hexahydro-2H-furo[3,2-b]chromen-8-one |
|---|---|
| PubChem CID | 139589793 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (2R,3aR,5S,9aR)-2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-5-hydroxy-3a-methyl-3,5,6,7,9,9a-hexahydro-2H-furo[3,2-b]chromen-8-one |
| SMILES | CC(C)=CCC/C(C)=C/[C@H]1C[C@@]2(C)OC3=C(C[C@H]2O1)C(=O)CC[C@@H]3O |
| InChI | InChI=1S/C21H30O4/c1-13(2)6-5-7-14(3)10-15-12-21(4)19(24-15)11-16-17(22)8-9-18(23)20(16)25-21/h6,10,15,18-19,23H,5,7-9,11-12H2,1-4H3/b14-10+/t15-,18-,19+,21+/m0/s1 |
| InChIKey | QCNXEAUXCVROLM-XVSBMABSSA-N |
| XLogP | 3.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|