C16H18O4 — CID 139589802
(4aR,5S,9aS)-9a-methoxy-3,4a,5-trimethyl-4,5-dihydrobenzo[f][1]benzofuran-2,8-dione (PubChem CID 139589802) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (4aR,5S,9aS)-9a-methoxy-3,4a,5-trimethyl-4,5-dihydrobenzo[f][1]benzofuran-2,8-dione.
| Compound Name | (4aR,5S,9aS)-9a-methoxy-3,4a,5-trimethyl-4,5-dihydrobenzo[f][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 139589802 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (4aR,5S,9aS)-9a-methoxy-3,4a,5-trimethyl-4,5-dihydrobenzo[f][1]benzofuran-2,8-dione |
| SMILES | CO[C@]12C=C3C(=O)C=C[C@H](C)[C@@]3(C)CC1=C(C)C(=O)O2 |
| InChI | InChI=1S/C16H18O4/c1-9-5-6-13(17)12-8-16(19-4)11(7-15(9,12)3)10(2)14(18)20-16/h5-6,8-9H,7H2,1-4H3/t9-,15+,16-/m0/s1 |
| InChIKey | NDZDSGGUQYVLAF-OBPXBXINSA-N |
| XLogP | 2.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |