C24H26O7 — CID 139589818
(1R,2R,10S,13R,15R,18R,19S,21S)-7,7,13,18,21-pentamethylspiro[6,11,14,16-tetraoxahexacyclo[16.3.1.03,8.010,21.012,20.015,19]docosa-3,8,12(20)-triene-2,2'-oxirane]-5,17-dione (PubChem CID 139589818) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is (1R,2R,10S,13R,15R,18R,19S,21S)-7,7,13,18,21-pentamethylspiro[6,11,14,16-tetraoxahexacyclo[16.3.1.03,8.010,21.012,20.015,19]docosa-3,8,12(20)-triene-2,2'-oxirane]-5,17-dione.
| Compound Name | (1R,2R,10S,13R,15R,18R,19S,21S)-7,7,13,18,21-pentamethylspiro[6,11,14,16-tetraoxahexacyclo[16.3.1.03,8.010,21.012,20.015,19]docosa-3,8,12(20)-triene-2,2'-oxirane]-5,17-dione |
|---|---|
| PubChem CID | 139589818 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (1R,2R,10S,13R,15R,18R,19S,21S)-7,7,13,18,21-pentamethylspiro[6,11,14,16-tetraoxahexacyclo[16.3.1.03,8.010,21.012,20.015,19]docosa-3,8,12(20)-triene-2,2'-oxirane]-5,17-dione |
| SMILES | C[C@H]1O[C@@H]2OC(=O)[C@]3(C)C[C@@H]4[C@@]5(C)C(=C1O[C@H]5C=C1C(=CC(=O)OC1(C)C)[C@@]41CO1)[C@H]23 |
| InChI | InChI=1S/C24H26O7/c1-10-18-16-17-19(28-10)30-20(26)22(17,4)8-13-23(16,5)14(29-18)6-11-12(24(13)9-27-24)7-15(25)31-21(11,2)3/h6-7,10,13-14,17,19H,8-9H2,1-5H3/t10-,13-,14+,17-,19-,22-,23-,24+/m1/s1 |
| InChIKey | RGQOTIXSCBSMSR-UHRNAULPSA-N |
| XLogP | 2.56 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|