C24H34O6 — CID 139589831
(3S,3'S,3aS,6R,6aR)-6-hexyl-3'-[(E)-2-[(2S,3S,5R)-3-hydroxy-5-methyloxolan-2-yl]ethenyl]spiro[6,6a-dihydro-3aH-furo[3,4-b]furan-3,4'-cyclohexene]-2,4-dione (PubChem CID 139589831) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is (3S,3'S,3aS,6R,6aR)-6-hexyl-3'-[(E)-2-[(2S,3S,5R)-3-hydroxy-5-methyloxolan-2-yl]ethenyl]spiro[6,6a-dihydro-3aH-furo[3,4-b]furan-3,4'-cyclohexene]-2,4-dione.
| Compound Name | (3S,3'S,3aS,6R,6aR)-6-hexyl-3'-[(E)-2-[(2S,3S,5R)-3-hydroxy-5-methyloxolan-2-yl]ethenyl]spiro[6,6a-dihydro-3aH-furo[3,4-b]furan-3,4'-cyclohexene]-2,4-dione |
|---|---|
| PubChem CID | 139589831 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (3S,3'S,3aS,6R,6aR)-6-hexyl-3'-[(E)-2-[(2S,3S,5R)-3-hydroxy-5-methyloxolan-2-yl]ethenyl]spiro[6,6a-dihydro-3aH-furo[3,4-b]furan-3,4'-cyclohexene]-2,4-dione |
| SMILES | CCCCCC[C@H]1OC(=O)[C@@H]2[C@H]1OC(=O)[C@]21CCC=C[C@H]1/C=C/[C@@H]1O[C@H](C)C[C@@H]1O |
| InChI | InChI=1S/C24H34O6/c1-3-4-5-6-10-19-21-20(22(26)29-19)24(23(27)30-21)13-8-7-9-16(24)11-12-18-17(25)14-15(2)28-18/h7,9,11-12,15-21,25H,3-6,8,10,13-14H2,1-2H3/b12-11+/t15-,16+,17+,18+,19-,20+,21+,24+/m1/s1 |
| InChIKey | WDMFLGRPNWGRCQ-RYMDFCTKSA-N |
| XLogP | 3.47 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|