C16H24O4 — CID 139589838
(1S,2S,4S,5S,10R,11S,14R)-14-hydroxy-5,10,14-trimethyl-3,6-dioxatetracyclo[9.4.0.02,4.05,10]pentadecan-7-one (PubChem CID 139589838) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (1S,2S,4S,5S,10R,11S,14R)-14-hydroxy-5,10,14-trimethyl-3,6-dioxatetracyclo[9.4.0.02,4.05,10]pentadecan-7-one.
| Compound Name | (1S,2S,4S,5S,10R,11S,14R)-14-hydroxy-5,10,14-trimethyl-3,6-dioxatetracyclo[9.4.0.02,4.05,10]pentadecan-7-one |
|---|---|
| PubChem CID | 139589838 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (1S,2S,4S,5S,10R,11S,14R)-14-hydroxy-5,10,14-trimethyl-3,6-dioxatetracyclo[9.4.0.02,4.05,10]pentadecan-7-one |
| SMILES | C[C@@]1(O)CC[C@H]2[C@H](C1)[C@@H]1O[C@@H]1[C@@]1(C)OC(=O)CC[C@]21C |
| InChI | InChI=1S/C16H24O4/c1-14(18)6-4-10-9(8-14)12-13(19-12)16(3)15(10,2)7-5-11(17)20-16/h9-10,12-13,18H,4-8H2,1-3H3/t9-,10-,12-,13-,14+,15+,16+/m0/s1 |
| InChIKey | QHCSIRRKZRCGAM-KLRPXXPBSA-N |
| XLogP | 2.04 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|