C15H24O3 — CID 139589843
1-[(1R,4R,4aS,6R,8aS)-4,6-dihydroxy-1,2,6-trimethyl-4,4a,5,7,8,8a-hexahydronaphthalen-1-yl]ethanone (PubChem CID 139589843) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 1-[(1R,4R,4aS,6R,8aS)-4,6-dihydroxy-1,2,6-trimethyl-4,4a,5,7,8,8a-hexahydronaphthalen-1-yl]ethanone.
| Compound Name | 1-[(1R,4R,4aS,6R,8aS)-4,6-dihydroxy-1,2,6-trimethyl-4,4a,5,7,8,8a-hexahydronaphthalen-1-yl]ethanone |
|---|---|
| PubChem CID | 139589843 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 1-[(1R,4R,4aS,6R,8aS)-4,6-dihydroxy-1,2,6-trimethyl-4,4a,5,7,8,8a-hexahydronaphthalen-1-yl]ethanone |
| SMILES | CC(=O)[C@@]1(C)C(C)=C[C@H](O)[C@H]2C[C@](C)(O)CC[C@@H]21 |
| InChI | InChI=1S/C15H24O3/c1-9-7-13(17)11-8-14(3,18)6-5-12(11)15(9,4)10(2)16/h7,11-13,17-18H,5-6,8H2,1-4H3/t11-,12-,13-,14+,15+/m0/s1 |
| InChIKey | PSPJTNLAMKKYRC-BTFPBAQTSA-N |
| XLogP | 2.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|