C18H28O5 — CID 139589846
[3-[(1R,2R,4aR,6R,8aS)-2,6-dihydroxy-1,2,6-trimethyl-5,7,8,8a-tetrahydro-4aH-naphthalen-1-yl]-3-oxopropyl] acetate (PubChem CID 139589846) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is [3-[(1R,2R,4aR,6R,8aS)-2,6-dihydroxy-1,2,6-trimethyl-5,7,8,8a-tetrahydro-4aH-naphthalen-1-yl]-3-oxopropyl] acetate.
| Compound Name | [3-[(1R,2R,4aR,6R,8aS)-2,6-dihydroxy-1,2,6-trimethyl-5,7,8,8a-tetrahydro-4aH-naphthalen-1-yl]-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 139589846 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | [3-[(1R,2R,4aR,6R,8aS)-2,6-dihydroxy-1,2,6-trimethyl-5,7,8,8a-tetrahydro-4aH-naphthalen-1-yl]-3-oxopropyl] acetate |
| SMILES | CC(=O)OCCC(=O)[C@]1(C)[C@H]2CC[C@@](C)(O)C[C@@H]2C=C[C@@]1(C)O |
| InChI | InChI=1S/C18H28O5/c1-12(19)23-10-7-15(20)18(4)14-6-8-16(2,21)11-13(14)5-9-17(18,3)22/h5,9,13-14,21-22H,6-8,10-11H2,1-4H3/t13-,14-,16+,17+,18-/m0/s1 |
| InChIKey | BGIMHGNGLYDQMW-TVNOUSRMSA-N |
| XLogP | 2.00 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|