About Libertalide C
Libertalide C (PubChem CID 139589848) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 1-[(1R,2R,4aR,6R,8aS)-2,6-dihydroxy-1,2,6-trimethyl-5,7,8,8a-tetrahydro-4aH-naphthalen-1-yl]ethanone.
Molecular Properties
| Compound Name | Libertalide C |
| PubChem CID | 139589848 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 1-[(1R,2R,4aR,6R,8aS)-2,6-dihydroxy-1,2,6-trimethyl-5,7,8,8a-tetrahydro-4aH-naphthalen-1-yl]ethanone |
| SMILES | CC(=O)[C@@]1([C@H]2CC[C@@](C[C@@H]2C=C[C@@]1(C)O)(C)O)C |
| InChI | InChI=1S/C15H24O3/c1-10(16)15(4)12-6-7-13(2,17)9-11(12)5-8-14(15,3)18/h5,8,11-12,17-18H,6-7,9H2,1-4H3/t11-,12-,13+,14+,15+/m0/s1 |
| InChIKey | YAYPYLHOLGSFLY-VQJWOFKYSA-N |
| XLogP | 1.50 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | 403 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Libertalide C with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Libertalide C?
The IUPAC name of Libertalide C (CID 139589848) is 1-[(1R,2R,4aR,6R,8aS)-2,6-dihydroxy-1,2,6-trimethyl-5,7,8,8a-tetrahydro-4aH-naphthalen-1-yl]ethanone.
What is the SMILES notation for Libertalide C?
The canonical SMILES for Libertalide C is CC(=O)[C@@]1([C@H]2CC[C@@](C[C@@H]2C=C[C@@]1(C)O)(C)O)C.
What is the InChIKey of Libertalide C?
The InChIKey is YAYPYLHOLGSFLY-VQJWOFKYSA-N. The full InChI is InChI=1S/C15H24O3/c1-10(16)15(4)12-6-7-13(2,17)9-11(12)5-8-14(15,3)18/h5,8,11-12,17-18H,6-7,9H2,1-4H3/t11-,12-,13+,14+,15+/m0/s1.
What are the key properties of Libertalide C?
Libertalide C has a molecular weight of 252.35 g/mol, XLogP of 1.50, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Libertalide C is sourced from PubChem (CID 139589848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).