C23H34O5 — CID 139589861
methyl (1S,2R,4S,5R)-4-[(1E,3E,5R,7E,9E,11S)-13-hydroxy-5,7,11-trimethyltrideca-1,3,7,9-tetraenyl]-5-methyl-3,6-dioxabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 139589861) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is methyl (1S,2R,4S,5R)-4-[(1E,3E,5R,7E,9E,11S)-13-hydroxy-5,7,11-trimethyltrideca-1,3,7,9-tetraenyl]-5-methyl-3,6-dioxabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | methyl (1S,2R,4S,5R)-4-[(1E,3E,5R,7E,9E,11S)-13-hydroxy-5,7,11-trimethyltrideca-1,3,7,9-tetraenyl]-5-methyl-3,6-dioxabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 139589861 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | methyl (1S,2R,4S,5R)-4-[(1E,3E,5R,7E,9E,11S)-13-hydroxy-5,7,11-trimethyltrideca-1,3,7,9-tetraenyl]-5-methyl-3,6-dioxabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@@H](/C=C/C=C/[C@H](C)C/C(C)=C/C=C/[C@@H](C)CCO)[C@@]2(C)O[C@@H]12 |
| InChI | InChI=1S/C23H34O5/c1-16(13-14-24)10-8-11-18(3)15-17(2)9-6-7-12-19-23(4)21(28-23)20(27-19)22(25)26-5/h6-12,16-17,19-21,24H,13-15H2,1-5H3/b9-6+,10-8+,12-7+,18-11+/t16-,17+,19+,20-,21+,23-/m1/s1 |
| InChIKey | SAKGBVJMAACEPL-ZAECHEIGSA-N |
| XLogP | 3.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|