C25H38O2 — CID 139589865
(1R,3S,4R,7S,11S,12R)-4-hydroxy-1,4,8-trimethyl-12-[(2S,3Z)-6-methylhepta-3,5-dien-2-yl]tricyclo[9.3.0.03,7]tetradec-8-en-6-one (PubChem CID 139589865) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is (1R,3S,4R,7S,11S,12R)-4-hydroxy-1,4,8-trimethyl-12-[(2S,3Z)-6-methylhepta-3,5-dien-2-yl]tricyclo[9.3.0.03,7]tetradec-8-en-6-one.
| Compound Name | (1R,3S,4R,7S,11S,12R)-4-hydroxy-1,4,8-trimethyl-12-[(2S,3Z)-6-methylhepta-3,5-dien-2-yl]tricyclo[9.3.0.03,7]tetradec-8-en-6-one |
|---|---|
| PubChem CID | 139589865 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | (1R,3S,4R,7S,11S,12R)-4-hydroxy-1,4,8-trimethyl-12-[(2S,3Z)-6-methylhepta-3,5-dien-2-yl]tricyclo[9.3.0.03,7]tetradec-8-en-6-one |
| SMILES | CC(C)=C/C=C\[C@H](C)[C@H]1CC[C@]2(C)C[C@H]3[C@H](C(=O)C[C@@]3(C)O)C(C)=CC[C@@H]12 |
| InChI | InChI=1S/C25H38O2/c1-16(2)8-7-9-17(3)19-12-13-24(5)14-21-23(18(4)10-11-20(19)24)22(26)15-25(21,6)27/h7-10,17,19-21,23,27H,11-15H2,1-6H3/b9-7-,18-10?/t17-,19+,20-,21-,23+,24+,25+/m0/s1 |
| InChIKey | PNRUVGYCBDDNBW-RENLWNAWSA-N |
| XLogP | 5.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|