C22H25NO7 — CID 139589877
[(5R,5aR,6S,9aR,9bR)-5-hydroxy-6,9a-dimethyl-3-oxo-5,5a,7,8,9,9b-hexahydro-1H-benzo[e][2]benzofuran-6-yl]methyl 4-nitrobenzoate (PubChem CID 139589877) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is [(5R,5aR,6S,9aR,9bR)-5-hydroxy-6,9a-dimethyl-3-oxo-5,5a,7,8,9,9b-hexahydro-1H-benzo[e][2]benzofuran-6-yl]methyl 4-nitrobenzoate.
| Compound Name | [(5R,5aR,6S,9aR,9bR)-5-hydroxy-6,9a-dimethyl-3-oxo-5,5a,7,8,9,9b-hexahydro-1H-benzo[e][2]benzofuran-6-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 139589877 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | [(5R,5aR,6S,9aR,9bR)-5-hydroxy-6,9a-dimethyl-3-oxo-5,5a,7,8,9,9b-hexahydro-1H-benzo[e][2]benzofuran-6-yl]methyl 4-nitrobenzoate |
| SMILES | C[C@]1(COC(=O)c2ccc([N+](=O)[O-])cc2)CCC[C@]2(C)[C@H]3COC(=O)C3=C[C@@H](O)[C@@H]12 |
| InChI | InChI=1S/C22H25NO7/c1-21(12-30-19(25)13-4-6-14(7-5-13)23(27)28)8-3-9-22(2)16-11-29-20(26)15(16)10-17(24)18(21)22/h4-7,10,16-18,24H,3,8-9,11-12H2,1-2H3/t16-,17+,18-,21+,22+/m0/s1 |
| InChIKey | OJYDAIRJVVQDEZ-PEVTXAFISA-N |
| XLogP | 3.04 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|