C24H27NO9 — CID 139589878
[(5R,5aS,6S,9aS,9bS)-6-(acetyloxymethyl)-9b-hydroxy-6,9a-dimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] 4-nitrobenzoate (PubChem CID 139589878) has the molecular formula C24H27NO9 and a molecular weight of 473.48 g/mol. Its IUPAC name is [(5R,5aS,6S,9aS,9bS)-6-(acetyloxymethyl)-9b-hydroxy-6,9a-dimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] 4-nitrobenzoate.
| Compound Name | [(5R,5aS,6S,9aS,9bS)-6-(acetyloxymethyl)-9b-hydroxy-6,9a-dimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 139589878 |
| Molecular Formula | C24H27NO9 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | [(5R,5aS,6S,9aS,9bS)-6-(acetyloxymethyl)-9b-hydroxy-6,9a-dimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] 4-nitrobenzoate |
| SMILES | CC(=O)OC[C@@]1(C)CCC[C@@]2(C)[C@H]1[C@H](OC(=O)c1ccc([N+](=O)[O-])cc1)C=C1C(=O)OC[C@@]12O |
| InChI | InChI=1S/C24H27NO9/c1-14(26)32-12-22(2)9-4-10-23(3)19(22)18(11-17-21(28)33-13-24(17,23)29)34-20(27)15-5-7-16(8-6-15)25(30)31/h5-8,11,18-19,29H,4,9-10,12-13H2,1-3H3/t18-,19+,22-,23+,24-/m1/s1 |
| InChIKey | INLGDUWRFZHZNN-GLUARIRHSA-N |
| XLogP | 2.72 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|