C17H24O7 — CID 139589908
[(1'S,2R,2'S,3S,3aR,4S,7aS)-2,2'-dihydroxy-2,3',4-trimethyl-7-oxospiro[3a,4,5,7a-tetrahydrofuro[2,3-c]pyran-3,6'-cyclohex-3-ene]-1'-yl] acetate (PubChem CID 139589908) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is [(1'S,2R,2'S,3S,3aR,4S,7aS)-2,2'-dihydroxy-2,3',4-trimethyl-7-oxospiro[3a,4,5,7a-tetrahydrofuro[2,3-c]pyran-3,6'-cyclohex-3-ene]-1'-yl] acetate.
| Compound Name | [(1'S,2R,2'S,3S,3aR,4S,7aS)-2,2'-dihydroxy-2,3',4-trimethyl-7-oxospiro[3a,4,5,7a-tetrahydrofuro[2,3-c]pyran-3,6'-cyclohex-3-ene]-1'-yl] acetate |
|---|---|
| PubChem CID | 139589908 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | [(1'S,2R,2'S,3S,3aR,4S,7aS)-2,2'-dihydroxy-2,3',4-trimethyl-7-oxospiro[3a,4,5,7a-tetrahydrofuro[2,3-c]pyran-3,6'-cyclohex-3-ene]-1'-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)C(C)=CC[C@]12[C@H]1[C@H](C)COC(=O)[C@H]1O[C@@]2(C)O |
| InChI | InChI=1S/C17H24O7/c1-8-5-6-17(14(12(8)19)23-10(3)18)11-9(2)7-22-15(20)13(11)24-16(17,4)21/h5,9,11-14,19,21H,6-7H2,1-4H3/t9-,11+,12+,13+,14-,16-,17+/m1/s1 |
| InChIKey | YCSRFLMEGDYMGX-DSFMCHPJSA-N |
| XLogP | 0.53 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|