C26H40O7 — CID 139589917
(1R,2S)-1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2,3-tricarboxylic acid (PubChem CID 139589917) has the molecular formula C26H40O7 and a molecular weight of 464.60 g/mol. Its IUPAC name is (1R,2S)-1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2,3-tricarboxylic acid.
| Compound Name | (1R,2S)-1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 139589917 |
| Molecular Formula | C26H40O7 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | (1R,2S)-1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]propane-1,2,3-tricarboxylic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CO[C@@H](C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H40O7/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21(5)15-16-33-24(26(31)32)22(25(29)30)17-23(27)28/h9,11,13,15,22,24H,6-8,10,12,14,16-17H2,1-5H3,(H,27,28)(H,29,30)(H,31,32)/b19-11+,20-13+,21-15+/t22?,24-/m1/s1 |
| InChIKey | ARIRKWOGKXMXSQ-FODWBHGVSA-N |
| XLogP | 5.78 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|