C21H32O7 — CID 139589921
(1R,2S)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propane-1,2,3-tricarboxylic acid (PubChem CID 139589921) has the molecular formula C21H32O7 and a molecular weight of 396.48 g/mol. Its IUPAC name is (1R,2S)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propane-1,2,3-tricarboxylic acid.
| Compound Name | (1R,2S)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 139589921 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | (1R,2S)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propane-1,2,3-tricarboxylic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CO[C@@H](C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H32O7/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-28-19(21(26)27)17(20(24)25)13-18(22)23/h7,9,11,17,19H,5-6,8,10,12-13H2,1-4H3,(H,22,23)(H,24,25)(H,26,27)/b15-9+,16-11+/t17?,19-/m1/s1 |
| InChIKey | WNCOHPCRBBRDAX-VXHPAAODSA-N |
| XLogP | 4.05 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|