C26H42O9 — CID 139589923
(1R,2S)-1-[(2E,6E,10E,14S)-14,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10-trienoxy]propane-1,2,3-tricarboxylic acid (PubChem CID 139589923) has the molecular formula C26H42O9 and a molecular weight of 498.61 g/mol. Its IUPAC name is (1R,2S)-1-[(2E,6E,10E,14S)-14,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10-trienoxy]propane-1,2,3-tricarboxylic acid.
| Compound Name | (1R,2S)-1-[(2E,6E,10E,14S)-14,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10-trienoxy]propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 139589923 |
| Molecular Formula | C26H42O9 |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | (1R,2S)-1-[(2E,6E,10E,14S)-14,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10-trienoxy]propane-1,2,3-tricarboxylic acid |
| SMILES | C/C(=C\CC/C(C)=C/CO[C@@H](C(=O)O)C(CC(=O)O)C(=O)O)CC/C=C(\C)CC[C@H](O)C(C)(C)O |
| InChI | InChI=1S/C26H42O9/c1-17(8-6-10-18(2)12-13-21(27)26(4,5)34)9-7-11-19(3)14-15-35-23(25(32)33)20(24(30)31)16-22(28)29/h9-10,14,20-21,23,27,34H,6-8,11-13,15-16H2,1-5H3,(H,28,29)(H,30,31)(H,32,33)/b17-9+,18-10+,19-14+/t20?,21-,23+/m0/s1 |
| InChIKey | DPCUSWYDKNTEFG-XSASTSCJSA-N |
| XLogP | 3.94 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|